About (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine
(Z)-2-N,6-dimethylhept-3-ene-2,5-diimine (PubChem CID 122450897) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine.
Molecular Properties
| Compound Name | (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine |
| PubChem CID | 122450897 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine |
| SMILES | [H]/N=C(/C=C\C(C)=N\C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-7(2)9(10)6-5-8(3)11-4/h5-7,10H,1-4H3/b6-5-,10-9-,11-8+ |
| InChIKey | MCFSXYWFGHISEF-NFILRFLKSA-N |
| XLogP | 2.31 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine?
The IUPAC name of (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine (CID 122450897) is (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine.
What is the SMILES notation for (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine?
The canonical SMILES for (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine is [H]/N=C(/C=C\C(C)=N\C)C(C)C.
What is the InChIKey of (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine?
The InChIKey is MCFSXYWFGHISEF-NFILRFLKSA-N. The full InChI is InChI=1S/C9H16N2/c1-7(2)9(10)6-5-8(3)11-4/h5-7,10H,1-4H3/b6-5-,10-9-,11-8+.
What are the key properties of (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine?
(Z)-2-N,6-dimethylhept-3-ene-2,5-diimine has a molecular weight of 152.24 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N,6-dimethylhept-3-ene-2,5-diimine is sourced from PubChem (CID 122450897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).