About propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate
propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate (PubChem CID 122451292) has the molecular formula C20H27NO4
and a molecular weight of 345.44 g/mol. Its IUPAC name is propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate |
| PubChem CID | 122451292 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc2c(c1)OCCN(C(=O)C1CCCCC1)C2 |
| InChI | InChI=1S/C20H27NO4/c1-14(2)25-20(23)16-8-9-17-13-21(10-11-24-18(17)12-16)19(22)15-6-4-3-5-7-15/h8-9,12,14-15H,3-7,10-11,13H2,1-2H3 |
| InChIKey | KQVPRJIHZLKFAF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate?
The IUPAC name of propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate (CID 122451292) is propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate.
What is the SMILES notation for propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate?
The canonical SMILES for propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate is CC(C)OC(=O)c1ccc2c(c1)OCCN(C(=O)C1CCCCC1)C2.
What is the InChIKey of propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate?
The InChIKey is KQVPRJIHZLKFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO4/c1-14(2)25-20(23)16-8-9-17-13-21(10-11-24-18(17)12-16)19(22)15-6-4-3-5-7-15/h8-9,12,14-15H,3-7,10-11,13H2,1-2H3.
What are the key properties of propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate?
propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate has a molecular weight of 345.44 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-(cyclohexanecarbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxylate is sourced from PubChem (CID 122451292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).