About (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane
(3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane (PubChem CID 122451378) has the molecular formula C12H22FN
and a molecular weight of 199.31 g/mol. Its IUPAC name is (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane |
| PubChem CID | 122451378 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane |
| SMILES | CC(C)[C@@H]1C2CC(CC2F)N1C(C)C |
| InChI | InChI=1S/C12H22FN/c1-7(2)12-10-5-9(6-11(10)13)14(12)8(3)4/h7-12H,5-6H2,1-4H3/t9?,10?,11?,12-/m1/s1 |
| InChIKey | ASGAISVATDHEDN-XHUCQOSOSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane?
The IUPAC name of (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane (CID 122451378) is (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane.
What is the SMILES notation for (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane?
The canonical SMILES for (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane is CC(C)[C@@H]1C2CC(CC2F)N1C(C)C.
What is the InChIKey of (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane?
The InChIKey is ASGAISVATDHEDN-XHUCQOSOSA-N. The full InChI is InChI=1S/C12H22FN/c1-7(2)12-10-5-9(6-11(10)13)14(12)8(3)4/h7-12H,5-6H2,1-4H3/t9?,10?,11?,12-/m1/s1.
What are the key properties of (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane?
(3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane has a molecular weight of 199.31 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-fluoro-2,3-di(propan-2-yl)-2-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 122451378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).