About (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane
(6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane (PubChem CID 122451395) has the molecular formula C12H21F2N
and a molecular weight of 217.30 g/mol. Its IUPAC name is (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane.
Molecular Properties
| Compound Name | (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane |
| PubChem CID | 122451395 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane |
| SMILES | CC(C)[C@@H]1CC2(CN1C(C)C)CC2(F)F |
| InChI | InChI=1S/C12H21F2N/c1-8(2)10-5-11(6-12(11,13)14)7-15(10)9(3)4/h8-10H,5-7H2,1-4H3/t10-,11?/m0/s1 |
| InChIKey | XEPHIGPIAFWMIA-VUWPPUDQSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane?
The IUPAC name of (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane (CID 122451395) is (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane.
What is the SMILES notation for (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane?
The canonical SMILES for (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane is CC(C)[C@@H]1CC2(CN1C(C)C)CC2(F)F.
What is the InChIKey of (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane?
The InChIKey is XEPHIGPIAFWMIA-VUWPPUDQSA-N. The full InChI is InChI=1S/C12H21F2N/c1-8(2)10-5-11(6-12(11,13)14)7-15(10)9(3)4/h8-10H,5-7H2,1-4H3/t10-,11?/m0/s1.
What are the key properties of (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane?
(6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane has a molecular weight of 217.30 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,2-difluoro-5,6-di(propan-2-yl)-5-azaspiro[2.4]heptane is sourced from PubChem (CID 122451395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).