About 2-fluoro-2-methyl-1,3-benzodioxol-5-ol
2-fluoro-2-methyl-1,3-benzodioxol-5-ol (PubChem CID 122451471) has the molecular formula C8H7FO3
and a molecular weight of 170.14 g/mol. Its IUPAC name is 2-fluoro-2-methyl-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 2-fluoro-2-methyl-1,3-benzodioxol-5-ol |
| PubChem CID | 122451471 |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2-fluoro-2-methyl-1,3-benzodioxol-5-ol |
| SMILES | CC1(F)Oc2ccc(O)cc2O1 |
| InChI | InChI=1S/C8H7FO3/c1-8(9)11-6-3-2-5(10)4-7(6)12-8/h2-4,10H,1H3 |
| InChIKey | QFCVRLFLBITTNP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-2-methyl-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-methyl-1,3-benzodioxol-5-ol?
The IUPAC name of 2-fluoro-2-methyl-1,3-benzodioxol-5-ol (CID 122451471) is 2-fluoro-2-methyl-1,3-benzodioxol-5-ol.
What is the SMILES notation for 2-fluoro-2-methyl-1,3-benzodioxol-5-ol?
The canonical SMILES for 2-fluoro-2-methyl-1,3-benzodioxol-5-ol is CC1(F)Oc2ccc(O)cc2O1.
What is the InChIKey of 2-fluoro-2-methyl-1,3-benzodioxol-5-ol?
The InChIKey is QFCVRLFLBITTNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO3/c1-8(9)11-6-3-2-5(10)4-7(6)12-8/h2-4,10H,1H3.
What are the key properties of 2-fluoro-2-methyl-1,3-benzodioxol-5-ol?
2-fluoro-2-methyl-1,3-benzodioxol-5-ol has a molecular weight of 170.14 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-methyl-1,3-benzodioxol-5-ol is sourced from PubChem (CID 122451471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).