About 5-propanoyloxyheptanoic acid
5-propanoyloxyheptanoic acid (PubChem CID 122451492) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-propanoyloxyheptanoic acid.
Molecular Properties
| Compound Name | 5-propanoyloxyheptanoic acid |
| PubChem CID | 122451492 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-propanoyloxyheptanoic acid |
| SMILES | CCC(=O)OC(CC)CCCC(=O)O |
| InChI | InChI=1S/C10H18O4/c1-3-8(14-10(13)4-2)6-5-7-9(11)12/h8H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | FZOOLWNEHMYFIV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propanoyloxyheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propanoyloxyheptanoic acid?
The IUPAC name of 5-propanoyloxyheptanoic acid (CID 122451492) is 5-propanoyloxyheptanoic acid.
What is the SMILES notation for 5-propanoyloxyheptanoic acid?
The canonical SMILES for 5-propanoyloxyheptanoic acid is CCC(=O)OC(CC)CCCC(=O)O.
What is the InChIKey of 5-propanoyloxyheptanoic acid?
The InChIKey is FZOOLWNEHMYFIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-3-8(14-10(13)4-2)6-5-7-9(11)12/h8H,3-7H2,1-2H3,(H,11,12).
What are the key properties of 5-propanoyloxyheptanoic acid?
5-propanoyloxyheptanoic acid has a molecular weight of 202.25 g/mol, XLogP of 1.97, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propanoyloxyheptanoic acid is sourced from PubChem (CID 122451492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).