C29H27N5O7S — CID 122451818
[3-ethyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate (PubChem CID 122451818) has the molecular formula C29H27N5O7S and a molecular weight of 589.63 g/mol. Its IUPAC name is [3-ethyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [3-ethyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 122451818 |
| Molecular Formula | C29H27N5O7S |
| Molecular Weight | 589.63 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [3-ethyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate |
| SMILES | CCC1CC(OC(=O)Oc2ccc([N+](=O)[O-])cc2)CC1c1cnc2cnc3c(ccn3S(=O)(=O)c3ccc(C)cc3)n12 |
| InChI | InChI=1S/C29H27N5O7S/c1-3-19-14-22(41-29(35)40-21-8-6-20(7-9-21)34(36)37)15-24(19)26-16-30-27-17-31-28-25(33(26)27)12-13-32(28)42(38,39)23-10-4-18(2)5-11-23/h4-13,16-17,19,22,24H,3,14-15H2,1-2H3 |
| InChIKey | BHKVLAPVMREZPD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 147.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|