C9H16N4 — CID 122451971
4-ethenyl-6-methylidene-5-propan-2-yl-1,4-dihydro-1,3,5-triazin-2-amine (PubChem CID 122451971) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-ethenyl-6-methylidene-5-propan-2-yl-1,4-dihydro-1,3,5-triazin-2-amine.
| Compound Name | 4-ethenyl-6-methylidene-5-propan-2-yl-1,4-dihydro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 122451971 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-ethenyl-6-methylidene-5-propan-2-yl-1,4-dihydro-1,3,5-triazin-2-amine |
| SMILES | C=CC1N=C(N)NC(=C)N1C(C)C |
| InChI | InChI=1S/C9H16N4/c1-5-8-12-9(10)11-7(4)13(8)6(2)3/h5-6,8H,1,4H2,2-3H3,(H3,10,11,12) |
| InChIKey | GZNMGUIATYHAFW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|