C23H18F3N3O4 — CID 122452272
2-cyanoethyl 2,6-dimethyl-7-oxo-4-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1H-pyrrolo[2,3-c]pyridine-3-carboxylate (PubChem CID 122452272) has the molecular formula C23H18F3N3O4 and a molecular weight of 457.41 g/mol. Its IUPAC name is 2-cyanoethyl 2,6-dimethyl-7-oxo-4-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1H-pyrrolo[2,3-c]pyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 2,6-dimethyl-7-oxo-4-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 122452272 |
| Molecular Formula | C23H18F3N3O4 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-cyanoethyl 2,6-dimethyl-7-oxo-4-(4,4,4-trifluoro-3-hydroxy-3-phenylbut-1-ynyl)-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
| SMILES | Cc1[nH]c2c(=O)n(C)cc(C#CC(O)(c3ccccc3)C(F)(F)F)c2c1C(=O)OCCC#N |
| InChI | InChI=1S/C23H18F3N3O4/c1-14-17(21(31)33-12-6-11-27)18-15(13-29(2)20(30)19(18)28-14)9-10-22(32,23(24,25)26)16-7-4-3-5-8-16/h3-5,7-8,13,28,32H,6,12H2,1-2H3 |
| InChIKey | LURFEQSTNVNWCA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|