C16H18N2O4 — CID 122452533
ethyl 4-(3-hydroxy-3-methylbut-1-ynyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate (PubChem CID 122452533) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethyl 4-(3-hydroxy-3-methylbut-1-ynyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 4-(3-hydroxy-3-methylbut-1-ynyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 122452533 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | ethyl 4-(3-hydroxy-3-methylbut-1-ynyl)-6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(=O)n(C)cc(C#CC(C)(C)O)c12 |
| InChI | InChI=1S/C16H18N2O4/c1-5-22-15(20)11-8-17-13-12(11)10(6-7-16(2,3)21)9-18(4)14(13)19/h8-9,17,21H,5H2,1-4H3 |
| InChIKey | PRYQHRRQQLCQDN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|