C16H26O — CID 122452595
(2Z,6Z)-2,6-bis(2,2-dimethylpropylidene)cyclohexan-1-one (PubChem CID 122452595) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (2Z,6Z)-2,6-bis(2,2-dimethylpropylidene)cyclohexan-1-one.
| Compound Name | (2Z,6Z)-2,6-bis(2,2-dimethylpropylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 122452595 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (2Z,6Z)-2,6-bis(2,2-dimethylpropylidene)cyclohexan-1-one |
| SMILES | CC(C)(C)/C=C1/CCC/C(=C/C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H26O/c1-15(2,3)10-12-8-7-9-13(14(12)17)11-16(4,5)6/h10-11H,7-9H2,1-6H3/b12-10-,13-11- |
| InChIKey | CMUQCDVANFYLGH-MIMPSMLTSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|