C21H23FN4O3S — CID 122453009
N-(4-fluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide (PubChem CID 122453009) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide.
| Compound Name | N-(4-fluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 122453009 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-(4-fluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
| SMILES | COCCOc1cnccc1CNC1=C(C(=S)Nc2ccc(F)cc2)C(=O)NCC1 |
| InChI | InChI=1S/C21H23FN4O3S/c1-28-10-11-29-18-13-23-8-6-14(18)12-25-17-7-9-24-20(27)19(17)21(30)26-16-4-2-15(22)3-5-16/h2-6,8,13,25H,7,9-12H2,1H3,(H,24,27)(H,26,30) |
| InChIKey | LOHMEUBBBJLMMO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|