C21H22F2N4O3S — CID 122453041
N-(3,4-difluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide (PubChem CID 122453041) has the molecular formula C21H22F2N4O3S and a molecular weight of 448.50 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide.
| Compound Name | N-(3,4-difluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 122453041 |
| Molecular Formula | C21H22F2N4O3S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-[[3-(2-methoxyethoxy)-4-pyridinyl]methylamino]-6-oxo-2,3-dihydro-1H-pyridine-5-carbothioamide |
| SMILES | COCCOc1cnccc1CNC1=C(C(=S)Nc2ccc(F)c(F)c2)C(=O)NCC1 |
| InChI | InChI=1S/C21H22F2N4O3S/c1-29-8-9-30-18-12-24-6-4-13(18)11-26-17-5-7-25-20(28)19(17)21(31)27-14-2-3-15(22)16(23)10-14/h2-4,6,10,12,26H,5,7-9,11H2,1H3,(H,25,28)(H,27,31) |
| InChIKey | PGXDYKFLFJDRIE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|