About 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole
4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole (PubChem CID 122454270) has the molecular formula C21H21N7S
and a molecular weight of 403.52 g/mol. Its IUPAC name is 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole |
| PubChem CID | 122454270 |
| Molecular Formula | C21H21N7S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole |
| SMILES | CCCCn1c(-c2ccc(-n3ccnc3)cc2C)cc2sc(-c3nn[nH]n3)cc21 |
| InChI | InChI=1S/C21H21N7S/c1-3-4-8-28-17(11-19-18(28)12-20(29-19)21-23-25-26-24-21)16-6-5-15(10-14(16)2)27-9-7-22-13-27/h5-7,9-13H,3-4,8H2,1-2H3,(H,23,24,25,26) |
| InChIKey | SBDDXLXAQHJPMZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole?
The IUPAC name of 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole (CID 122454270) is 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole.
What is the SMILES notation for 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole?
The canonical SMILES for 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole is CCCCn1c(-c2ccc(-n3ccnc3)cc2C)cc2sc(-c3nn[nH]n3)cc21.
What is the InChIKey of 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole?
The InChIKey is SBDDXLXAQHJPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N7S/c1-3-4-8-28-17(11-19-18(28)12-20(29-19)21-23-25-26-24-21)16-6-5-15(10-14(16)2)27-9-7-22-13-27/h5-7,9-13H,3-4,8H2,1-2H3,(H,23,24,25,26).
What are the key properties of 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole?
4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole has a molecular weight of 403.52 g/mol, XLogP of 4.84, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-(4-imidazol-1-yl-2-methylphenyl)-2-(2H-tetrazol-5-yl)thieno[3,2-b]pyrrole is sourced from PubChem (CID 122454270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).