About 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid
5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 122454348) has the molecular formula C20H20F3NO3S
and a molecular weight of 411.45 g/mol. Its IUPAC name is 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
| PubChem CID | 122454348 |
| Molecular Formula | C20H20F3NO3S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
| SMILES | COc1ccc(-c2cc3sc(C(=O)O)cc3n2CCC(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3NO3S/c1-11(2)6-7-24-15(9-17-16(24)10-18(28-17)19(25)26)13-5-4-12(27-3)8-14(13)20(21,22)23/h4-5,8-11H,6-7H2,1-3H3,(H,25,26) |
| InChIKey | OTHXBMKXADUABH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
The IUPAC name of 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid (CID 122454348) is 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid.
What is the SMILES notation for 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
The canonical SMILES for 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid is COc1ccc(-c2cc3sc(C(=O)O)cc3n2CCC(C)C)c(C(F)(F)F)c1.
What is the InChIKey of 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
The InChIKey is OTHXBMKXADUABH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3NO3S/c1-11(2)6-7-24-15(9-17-16(24)10-18(28-17)19(25)26)13-5-4-12(27-3)8-14(13)20(21,22)23/h4-5,8-11H,6-7H2,1-3H3,(H,25,26).
What are the key properties of 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid?
5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid has a molecular weight of 411.45 g/mol, XLogP of 6.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-methoxy-2-(trifluoromethyl)phenyl]-4-(3-methylbutyl)thieno[3,2-b]pyrrole-2-carboxylic acid is sourced from PubChem (CID 122454348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).