C12H15F6N3 — CID 122456123
[3-(trifluoromethyl)-1-[4-(trifluoromethyl)cyclohexyl]pyrazol-4-yl]methanamine (PubChem CID 122456123) has the molecular formula C12H15F6N3 and a molecular weight of 315.26 g/mol. Its IUPAC name is [3-(trifluoromethyl)-1-[4-(trifluoromethyl)cyclohexyl]pyrazol-4-yl]methanamine.
| Compound Name | [3-(trifluoromethyl)-1-[4-(trifluoromethyl)cyclohexyl]pyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 122456123 |
| Molecular Formula | C12H15F6N3 |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [3-(trifluoromethyl)-1-[4-(trifluoromethyl)cyclohexyl]pyrazol-4-yl]methanamine |
| SMILES | NCc1cn(C2CCC(C(F)(F)F)CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C12H15F6N3/c13-11(14,15)8-1-3-9(4-2-8)21-6-7(5-19)10(20-21)12(16,17)18/h6,8-9H,1-5,19H2 |
| InChIKey | LHPCLVVTVYRXSC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |