C12H16F3N5O — CID 122456391
(3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 122456391) has the molecular formula C12H16F3N5O and a molecular weight of 303.29 g/mol. Its IUPAC name is (3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 122456391 |
| Molecular Formula | C12H16F3N5O |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (3R)-1-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | Nc1nc(NC2CC2)cc(N2CC[C@](O)(C(F)(F)F)C2)n1 |
| InChI | InChI=1S/C12H16F3N5O/c13-12(14,15)11(21)3-4-20(6-11)9-5-8(17-7-1-2-7)18-10(16)19-9/h5,7,21H,1-4,6H2,(H3,16,17,18,19)/t11-/m1/s1 |
| InChIKey | FBVZVSNDEVGEMX-LLVKDONJSA-N |
| XLogP | 1.14 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |