About 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol
1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol (PubChem CID 122456428) has the molecular formula C10H15F2N5O
and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol.
Molecular Properties
| Compound Name | 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol |
| PubChem CID | 122456428 |
| Molecular Formula | C10H15F2N5O |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol |
| SMILES | CNc1cc(N2CC(O)CC(F)(F)C2)nc(N)n1 |
| InChI | InChI=1S/C10H15F2N5O/c1-14-7-2-8(16-9(13)15-7)17-4-6(18)3-10(11,12)5-17/h2,6,18H,3-5H2,1H3,(H3,13,14,15,16) |
| InChIKey | PGZGXFOQZYEODG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol?
The IUPAC name of 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol (CID 122456428) is 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol.
What is the SMILES notation for 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol?
The canonical SMILES for 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol is CNc1cc(N2CC(O)CC(F)(F)C2)nc(N)n1.
What is the InChIKey of 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol?
The InChIKey is PGZGXFOQZYEODG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2N5O/c1-14-7-2-8(16-9(13)15-7)17-4-6(18)3-10(11,12)5-17/h2,6,18H,3-5H2,1H3,(H3,13,14,15,16).
What are the key properties of 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol?
1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol has a molecular weight of 259.26 g/mol, XLogP of 0.31, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-amino-6-(methylamino)pyrimidin-4-yl]-5,5-difluoropiperidin-3-ol is sourced from PubChem (CID 122456428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).