About (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile
(1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile (PubChem CID 122456582) has the molecular formula C14H16N2O
and a molecular weight of 228.29 g/mol. Its IUPAC name is (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile.
Molecular Properties
| Compound Name | (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile |
| PubChem CID | 122456582 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile |
| SMILES | N#Cc1cccc2c1[C@H](C1CCCN1)OCC2 |
| InChI | InChI=1S/C14H16N2O/c15-9-11-4-1-3-10-6-8-17-14(13(10)11)12-5-2-7-16-12/h1,3-4,12,14,16H,2,5-8H2/t12?,14-/m0/s1 |
| InChIKey | HIEVZUIEZJLCDT-PYMCNQPYSA-N |
| XLogP | 1.92 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile?
The IUPAC name of (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile (CID 122456582) is (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile.
What is the SMILES notation for (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile?
The canonical SMILES for (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile is N#Cc1cccc2c1[C@H](C1CCCN1)OCC2.
What is the InChIKey of (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile?
The InChIKey is HIEVZUIEZJLCDT-PYMCNQPYSA-N. The full InChI is InChI=1S/C14H16N2O/c15-9-11-4-1-3-10-6-8-17-14(13(10)11)12-5-2-7-16-12/h1,3-4,12,14,16H,2,5-8H2/t12?,14-/m0/s1.
What are the key properties of (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile?
(1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile has a molecular weight of 228.29 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-pyrrolidin-2-yl-3,4-dihydro-1H-isochromene-8-carbonitrile is sourced from PubChem (CID 122456582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).