About 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine
2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine (PubChem CID 122456666) has the molecular formula C13H16ClNO
and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine.
Molecular Properties
| Compound Name | 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine |
| PubChem CID | 122456666 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine |
| SMILES | Clc1ccc2c(c1)CCO[C@H]2C1CCCN1 |
| InChI | InChI=1S/C13H16ClNO/c14-10-3-4-11-9(8-10)5-7-16-13(11)12-2-1-6-15-12/h3-4,8,12-13,15H,1-2,5-7H2/t12?,13-/m1/s1 |
| InChIKey | LTNZCRWPWRQSSL-ZGTCLIOFSA-N |
| XLogP | 2.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine?
The IUPAC name of 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine (CID 122456666) is 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine.
What is the SMILES notation for 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine?
The canonical SMILES for 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine is Clc1ccc2c(c1)CCO[C@H]2C1CCCN1.
What is the InChIKey of 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine?
The InChIKey is LTNZCRWPWRQSSL-ZGTCLIOFSA-N. The full InChI is InChI=1S/C13H16ClNO/c14-10-3-4-11-9(8-10)5-7-16-13(11)12-2-1-6-15-12/h3-4,8,12-13,15H,1-2,5-7H2/t12?,13-/m1/s1.
What are the key properties of 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine?
2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine has a molecular weight of 237.73 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-6-chloro-3,4-dihydro-1H-isochromen-1-yl]pyrrolidine is sourced from PubChem (CID 122456666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).