C8H9IN2O2 — CID 122458018
(6S)-3-iodo-4,5,6,7-tetrahydro-1H-indazole-6-carboxylic acid (PubChem CID 122458018) has the molecular formula C8H9IN2O2 and a molecular weight of 292.08 g/mol. Its IUPAC name is (6S)-3-iodo-4,5,6,7-tetrahydro-1H-indazole-6-carboxylic acid.
| Compound Name | (6S)-3-iodo-4,5,6,7-tetrahydro-1H-indazole-6-carboxylic acid |
|---|---|
| PubChem CID | 122458018 |
| Molecular Formula | C8H9IN2O2 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | (6S)-3-iodo-4,5,6,7-tetrahydro-1H-indazole-6-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCc2c(I)n[nH]c2C1 |
| InChI | InChI=1S/C8H9IN2O2/c9-7-5-2-1-4(8(12)13)3-6(5)10-11-7/h4H,1-3H2,(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | YVTXXCRCOGUTGO-BYPYZUCNSA-N |
| XLogP | 1.20 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|