C11H8ClF3O2 — CID 122458061
2-chloro-6-[1-(trifluoromethyl)cyclopropyl]benzoic acid (PubChem CID 122458061) has the molecular formula C11H8ClF3O2 and a molecular weight of 264.63 g/mol. Its IUPAC name is 2-chloro-6-[1-(trifluoromethyl)cyclopropyl]benzoic acid.
| Compound Name | 2-chloro-6-[1-(trifluoromethyl)cyclopropyl]benzoic acid |
|---|---|
| PubChem CID | 122458061 |
| Molecular Formula | C11H8ClF3O2 |
| Molecular Weight | 264.63 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-chloro-6-[1-(trifluoromethyl)cyclopropyl]benzoic acid |
| SMILES | O=C(O)c1c(Cl)cccc1C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H8ClF3O2/c12-7-3-1-2-6(8(7)9(16)17)10(4-5-10)11(13,14)15/h1-3H,4-5H2,(H,16,17) |
| InChIKey | IQXOOKVOCRHLAG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |