About 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide
4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide (PubChem CID 122458634) has the molecular formula C22H13ClF2N4O3S
and a molecular weight of 486.89 g/mol. Its IUPAC name is 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide.
Molecular Properties
| Compound Name | 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide |
| PubChem CID | 122458634 |
| Molecular Formula | C22H13ClF2N4O3S |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(-n2nc(-c3ccc(F)cc3F)c3cc(Cl)ccc32)c(C#N)c1 |
| InChI | InChI=1S/C22H13ClF2N4O3S/c1-33(31,32)28-22(30)12-2-6-19(13(8-12)11-26)29-20-7-3-14(23)9-17(20)21(27-29)16-5-4-15(24)10-18(16)25/h2-10H,1H3,(H,28,30) |
| InChIKey | QBWRRVSVOAPIEC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide?
The IUPAC name of 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide (CID 122458634) is 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide.
What is the SMILES notation for 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide?
The canonical SMILES for 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide is CS(=O)(=O)NC(=O)c1ccc(-n2nc(-c3ccc(F)cc3F)c3cc(Cl)ccc32)c(C#N)c1.
What is the InChIKey of 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide?
The InChIKey is QBWRRVSVOAPIEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13ClF2N4O3S/c1-33(31,32)28-22(30)12-2-6-19(13(8-12)11-26)29-20-7-3-14(23)9-17(20)21(27-29)16-5-4-15(24)10-18(16)25/h2-10H,1H3,(H,28,30).
What are the key properties of 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide?
4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide has a molecular weight of 486.89 g/mol, XLogP of 4.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-chloro-3-(2,4-difluorophenyl)indazol-1-yl]-3-cyano-N-methylsulfonylbenzamide is sourced from PubChem (CID 122458634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).