C38H66O4 — CID 122459016
bis(6-ethyltridecan-7-yl) benzene-1,4-dicarboxylate (PubChem CID 122459016) has the molecular formula C38H66O4 and a molecular weight of 586.94 g/mol. Its IUPAC name is bis(6-ethyltridecan-7-yl) benzene-1,4-dicarboxylate.
| Compound Name | bis(6-ethyltridecan-7-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 122459016 |
| Molecular Formula | C38H66O4 |
| Molecular Weight | 586.94 g/mol |
| Exact Mass | 586.50 |
| IUPAC Name | bis(6-ethyltridecan-7-yl) benzene-1,4-dicarboxylate |
| SMILES | CCCCCCC(OC(=O)c1ccc(C(=O)OC(CCCCCC)C(CC)CCCCC)cc1)C(CC)CCCCC |
| InChI | InChI=1S/C38H66O4/c1-7-13-17-21-25-35(31(11-5)23-19-15-9-3)41-37(39)33-27-29-34(30-28-33)38(40)42-36(26-22-18-14-8-2)32(12-6)24-20-16-10-4/h27-32,35-36H,7-26H2,1-6H3 |
| InChIKey | RSBWJRHQAHFKGI-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.94 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|