C26H48O4 — CID 122459034
1-O'-decyl 1-O-octyl cyclohexane-1,1-dicarboxylate (PubChem CID 122459034) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is 1-O'-decyl 1-O-octyl cyclohexane-1,1-dicarboxylate.
| Compound Name | 1-O'-decyl 1-O-octyl cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 122459034 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | 1-O'-decyl 1-O-octyl cyclohexane-1,1-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1(C(=O)OCCCCCCCC)CCCCC1 |
| InChI | InChI=1S/C26H48O4/c1-3-5-7-9-11-12-14-19-23-30-25(28)26(20-16-15-17-21-26)24(27)29-22-18-13-10-8-6-4-2/h3-23H2,1-2H3 |
| InChIKey | CMNKNIIJVWXZEN-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|