C22H26Cl3NO4S — CID 122459654
2-hydroxyethyl 5-[3-[(2R)-5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 122459654) has the molecular formula C22H26Cl3NO4S and a molecular weight of 506.88 g/mol. Its IUPAC name is 2-hydroxyethyl 5-[3-[(2R)-5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | 2-hydroxyethyl 5-[3-[(2R)-5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 122459654 |
| Molecular Formula | C22H26Cl3NO4S |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-hydroxyethyl 5-[3-[(2R)-5-chloro-2-[2-(2,6-dichloro-4-pyridinyl)ethyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | O=C(OCCO)c1ccc(CCCC2C(Cl)CC(O)[C@@H]2CCc2cc(Cl)nc(Cl)c2)s1 |
| InChI | InChI=1S/C22H26Cl3NO4S/c23-17-12-18(28)16(6-4-13-10-20(24)26-21(25)11-13)15(17)3-1-2-14-5-7-19(31-14)22(29)30-9-8-27/h5,7,10-11,15-18,27-28H,1-4,6,8-9,12H2/t15?,16-,17?,18?/m1/s1 |
| InChIKey | WLGUHPPYXGUPQG-JYJOREJMSA-N |
| XLogP | 5.16 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|