C26H26N4O4 — CID 122459891
1-[2-[benzyl(1-cyclopropylethyl)amino]-2-oxoethyl]-2,5-dioxospiro[imidazolidine-4,1'-indene]-4'-carboxamide (PubChem CID 122459891) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-[2-[benzyl(1-cyclopropylethyl)amino]-2-oxoethyl]-2,5-dioxospiro[imidazolidine-4,1'-indene]-4'-carboxamide.
| Compound Name | 1-[2-[benzyl(1-cyclopropylethyl)amino]-2-oxoethyl]-2,5-dioxospiro[imidazolidine-4,1'-indene]-4'-carboxamide |
|---|---|
| PubChem CID | 122459891 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-[2-[benzyl(1-cyclopropylethyl)amino]-2-oxoethyl]-2,5-dioxospiro[imidazolidine-4,1'-indene]-4'-carboxamide |
| SMILES | CC(C1CC1)N(Cc1ccccc1)C(=O)CN1C(=O)NC2(C=Cc3c(C(N)=O)cccc32)C1=O |
| InChI | InChI=1S/C26H26N4O4/c1-16(18-10-11-18)29(14-17-6-3-2-4-7-17)22(31)15-30-24(33)26(28-25(30)34)13-12-19-20(23(27)32)8-5-9-21(19)26/h2-9,12-13,16,18H,10-11,14-15H2,1H3,(H2,27,32)(H,28,34) |
| InChIKey | GXXOGDFVPXPFSU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|