C28H21F6N3O4 — CID 122460320
2-[(3R)-6-(2,4-difluoro-3-pyridinyl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 122460320) has the molecular formula C28H21F6N3O4 and a molecular weight of 577.48 g/mol. Its IUPAC name is 2-[(3R)-6-(2,4-difluoro-3-pyridinyl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | 2-[(3R)-6-(2,4-difluoro-3-pyridinyl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 122460320 |
| Molecular Formula | C28H21F6N3O4 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 2-[(3R)-6-(2,4-difluoro-3-pyridinyl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)O[C@@]2(CCc3cc(-c4c(F)ccnc4F)ccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C28H21F6N3O4/c1-15(28(32,33)34)36(13-16-2-5-19(29)6-3-16)22(38)14-37-25(39)27(41-26(37)40)10-8-17-12-18(4-7-20(17)27)23-21(30)9-11-35-24(23)31/h2-7,9,11-12,15H,8,10,13-14H2,1H3/t15-,27+/m0/s1 |
| InChIKey | UCWFJWJBHYSDIF-KUNJGFBQSA-N |
| XLogP | 5.27 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|