C29H33FN6O2 — CID 122460412
N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-pyrimidin-2-ylbenzamide (PubChem CID 122460412) has the molecular formula C29H33FN6O2 and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-pyrimidin-2-ylbenzamide.
| Compound Name | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-pyrimidin-2-ylbenzamide |
|---|---|
| PubChem CID | 122460412 |
| Molecular Formula | C29H33FN6O2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | N-[(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]-1-oxo-1-piperazin-1-ylpentan-2-yl]-4-pyrimidin-2-ylbenzamide |
| SMILES | O=C(N[C@@H](CCCN[C@@H]1C[C@H]1c1ccc(F)cc1)C(=O)N1CCNCC1)c1ccc(-c2ncccn2)cc1 |
| InChI | InChI=1S/C29H33FN6O2/c30-23-10-8-20(9-11-23)24-19-26(24)32-12-1-3-25(29(38)36-17-15-31-16-18-36)35-28(37)22-6-4-21(5-7-22)27-33-13-2-14-34-27/h2,4-11,13-14,24-26,31-32H,1,3,12,15-19H2,(H,35,37)/t24-,25-,26+/m0/s1 |
| InChIKey | OGBZQGIUYKINTK-KKUQBAQOSA-N |
| XLogP | 2.74 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|