About sodium;2,2-diethoxyethanimidamide;chloride
sodium;2,2-diethoxyethanimidamide;chloride (PubChem CID 122460864) has the molecular formula C6H14ClN2NaO2
and a molecular weight of 204.63 g/mol. Its IUPAC name is sodium;2,2-diethoxyethanimidamide;chloride.
Molecular Properties
| Compound Name | sodium;2,2-diethoxyethanimidamide;chloride |
| PubChem CID | 122460864 |
| Molecular Formula | C6H14ClN2NaO2 |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | sodium;2,2-diethoxyethanimidamide;chloride |
| SMILES | [Cl-].[H]/N=C(\N)C(OCC)OCC.[Na+] |
| InChI | InChI=1S/C6H14N2O2.ClH.Na/c1-3-9-6(5(7)8)10-4-2;;/h6H,3-4H2,1-2H3,(H3,7,8);1H;/q;;+1/p-1 |
| InChIKey | DHJUHARENVGPKL-UHFFFAOYSA-M |
| XLogP | -5.67 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | -5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2,2-diethoxyethanimidamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2,2-diethoxyethanimidamide;chloride?
The IUPAC name of sodium;2,2-diethoxyethanimidamide;chloride (CID 122460864) is sodium;2,2-diethoxyethanimidamide;chloride.
What is the SMILES notation for sodium;2,2-diethoxyethanimidamide;chloride?
The canonical SMILES for sodium;2,2-diethoxyethanimidamide;chloride is [Cl-].[H]/N=C(\N)C(OCC)OCC.[Na+].
What is the InChIKey of sodium;2,2-diethoxyethanimidamide;chloride?
The InChIKey is DHJUHARENVGPKL-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14N2O2.ClH.Na/c1-3-9-6(5(7)8)10-4-2;;/h6H,3-4H2,1-2H3,(H3,7,8);1H;/q;;+1/p-1.
What are the key properties of sodium;2,2-diethoxyethanimidamide;chloride?
sodium;2,2-diethoxyethanimidamide;chloride has a molecular weight of 204.63 g/mol, XLogP of -5.67, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2,2-diethoxyethanimidamide;chloride is sourced from PubChem (CID 122460864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).