C22H30F3N7 — CID 122461396
1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1,3-dimethyl-3-[2-(trifluoromethyl)phenyl]guanidine (PubChem CID 122461396) has the molecular formula C22H30F3N7 and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1,3-dimethyl-3-[2-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1,3-dimethyl-3-[2-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 122461396 |
| Molecular Formula | C22H30F3N7 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 1-[4-[(1-ethylpiperidin-3-yl)amino]-6-methylpyrimidin-2-yl]-1,3-dimethyl-3-[2-(trifluoromethyl)phenyl]guanidine |
| SMILES | [H]/N=C(\N(C)c1nc(C)cc(NC2CCCN(CC)C2)n1)N(C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H30F3N7/c1-5-32-12-8-9-16(14-32)28-19-13-15(2)27-21(29-19)31(4)20(26)30(3)18-11-7-6-10-17(18)22(23,24)25/h6-7,10-11,13,16,26H,5,8-9,12,14H2,1-4H3,(H,27,28,29)/b26-20- |
| InChIKey | PIKRDHSDMGQJRX-QOMWVZHYSA-N |
| XLogP | 4.21 |
| TPSA | 71.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|