C19H25Cl2N7 — CID 122461503
1-(3,4-dichlorophenyl)-2-[4-[[(3R)-1-ethylpiperidin-3-yl]amino]-6-methylpyrimidin-2-yl]guanidine (PubChem CID 122461503) has the molecular formula C19H25Cl2N7 and a molecular weight of 422.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[4-[[(3R)-1-ethylpiperidin-3-yl]amino]-6-methylpyrimidin-2-yl]guanidine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[4-[[(3R)-1-ethylpiperidin-3-yl]amino]-6-methylpyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 122461503 |
| Molecular Formula | C19H25Cl2N7 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[4-[[(3R)-1-ethylpiperidin-3-yl]amino]-6-methylpyrimidin-2-yl]guanidine |
| SMILES | CCN1CCC[C@@H](Nc2cc(C)nc(/N=C(\N)Nc3ccc(Cl)c(Cl)c3)n2)C1 |
| InChI | InChI=1S/C19H25Cl2N7/c1-3-28-8-4-5-14(11-28)24-17-9-12(2)23-19(26-17)27-18(22)25-13-6-7-15(20)16(21)10-13/h6-7,9-10,14H,3-5,8,11H2,1-2H3,(H4,22,23,24,25,26,27)/t14-/m1/s1 |
| InChIKey | ULEFBGMSKLBBKF-CQSZACIVSA-N |
| XLogP | 4.05 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|