C16H14N4S — CID 122461995
N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 122461995) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 122461995 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | c1cnc2c(c1)CCC/C2=N\Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14N4S/c1-2-9-14-12(7-1)18-16(21-14)20-19-13-8-3-5-11-6-4-10-17-15(11)13/h1-2,4,6-7,9-10H,3,5,8H2,(H,18,20)/b19-13+ |
| InChIKey | GYINVIIQVGQIDJ-CPNJWEJPSA-N |
| XLogP | 3.84 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|