C8H10F3N5O4 — CID 122462202
(2R)-3-azido-2-[[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanoic acid (PubChem CID 122462202) has the molecular formula C8H10F3N5O4 and a molecular weight of 297.19 g/mol. Its IUPAC name is (2R)-3-azido-2-[[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-azido-2-[[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122462202 |
| Molecular Formula | C8H10F3N5O4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (2R)-3-azido-2-[[(2R)-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)C(F)(F)F)C(=O)N[C@H](CN=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C8H10F3N5O4/c1-3(14-7(20)8(9,10)11)5(17)15-4(6(18)19)2-13-16-12/h3-4H,2H2,1H3,(H,14,20)(H,15,17)(H,18,19)/t3-,4-/m1/s1 |
| InChIKey | GLVXFXMIXYSHKC-QWWZWVQMSA-N |
| XLogP | -0.07 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|