About (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane
(3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane (PubChem CID 122462592) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane |
| PubChem CID | 122462592 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane |
| SMILES | C[C@@H]1C2CC(CC2F)N1C |
| InChI | InChI=1S/C8H14FN/c1-5-7-3-6(10(5)2)4-8(7)9/h5-8H,3-4H2,1-2H3/t5-,6?,7?,8?/m1/s1 |
| InChIKey | BWWGEQZLRFCWGN-NIYQRSRNSA-N |
| XLogP | 1.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane?
The IUPAC name of (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane (CID 122462592) is (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane.
What is the SMILES notation for (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane?
The canonical SMILES for (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane is C[C@@H]1C2CC(CC2F)N1C.
What is the InChIKey of (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane?
The InChIKey is BWWGEQZLRFCWGN-NIYQRSRNSA-N. The full InChI is InChI=1S/C8H14FN/c1-5-7-3-6(10(5)2)4-8(7)9/h5-8H,3-4H2,1-2H3/t5-,6?,7?,8?/m1/s1.
What are the key properties of (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane?
(3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane has a molecular weight of 143.20 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-fluoro-2,3-dimethyl-2-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 122462592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).