About (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one
(7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one (PubChem CID 122463214) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one.
Molecular Properties
| Compound Name | (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one |
| PubChem CID | 122463214 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one |
| SMILES | CC[C@H]1C2CNCC(=O)N21 |
| InChI | InChI=1S/C7H12N2O/c1-2-5-6-3-8-4-7(10)9(5)6/h5-6,8H,2-4H2,1H3/t5-,6?,9?/m0/s1 |
| InChIKey | JZIUGCCMZFIWGI-YXDJQVONSA-N |
| XLogP | -0.42 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one?
The IUPAC name of (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one (CID 122463214) is (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one.
What is the SMILES notation for (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one?
The canonical SMILES for (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one is CC[C@H]1C2CNCC(=O)N21.
What is the InChIKey of (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one?
The InChIKey is JZIUGCCMZFIWGI-YXDJQVONSA-N. The full InChI is InChI=1S/C7H12N2O/c1-2-5-6-3-8-4-7(10)9(5)6/h5-6,8H,2-4H2,1H3/t5-,6?,9?/m0/s1.
What are the key properties of (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one?
(7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one has a molecular weight of 140.19 g/mol, XLogP of -0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-ethyl-1,4-diazabicyclo[4.1.0]heptan-2-one is sourced from PubChem (CID 122463214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).