C18H21N5O2 — CID 122463228
N-[(E)-1-[4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethylideneamino]-1,3-benzoxazol-2-amine (PubChem CID 122463228) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[(E)-1-[4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethylideneamino]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(E)-1-[4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethylideneamino]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 122463228 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(E)-1-[4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethylideneamino]-1,3-benzoxazol-2-amine |
| SMILES | C/C(=N\Nc1nc2ccccc2o1)c1cc(OCCN(C)C)ccn1 |
| InChI | InChI=1S/C18H21N5O2/c1-13(16-12-14(8-9-19-16)24-11-10-23(2)3)21-22-18-20-15-6-4-5-7-17(15)25-18/h4-9,12H,10-11H2,1-3H3,(H,20,22)/b21-13+ |
| InChIKey | JMNKTXKHLZKHAQ-FYJGNVAPSA-N |
| XLogP | 3.00 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|