About N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine
N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine (PubChem CID 122463404) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine.
Molecular Properties
| Compound Name | N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine |
| PubChem CID | 122463404 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine |
| SMILES | c1ccc2c(c1)CCC21CC1NC1COC1 |
| InChI | InChI=1S/C14H17NO/c1-2-4-12-10(3-1)5-6-14(12)7-13(14)15-11-8-16-9-11/h1-4,11,13,15H,5-9H2 |
| InChIKey | GYDWBNKXAZAPSJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine?
The IUPAC name of N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine (CID 122463404) is N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine.
What is the SMILES notation for N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine?
The canonical SMILES for N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine is c1ccc2c(c1)CCC21CC1NC1COC1.
What is the InChIKey of N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine?
The InChIKey is GYDWBNKXAZAPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-2-4-12-10(3-1)5-6-14(12)7-13(14)15-11-8-16-9-11/h1-4,11,13,15H,5-9H2.
What are the key properties of N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine?
N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine has a molecular weight of 215.30 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-yloxetan-3-amine is sourced from PubChem (CID 122463404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).