About 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde
2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde (PubChem CID 122463564) has the molecular formula C27H27NO2
and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde.
Molecular Properties
| Compound Name | 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde |
| PubChem CID | 122463564 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde |
| SMILES | CC/C=c1/cc2c(cc1C)=C(c1ccccc1C=O)c1cc(C)c(NCC)cc1O2 |
| InChI | InChI=1S/C27H27NO2/c1-5-9-19-14-25-22(12-17(19)3)27(21-11-8-7-10-20(21)16-29)23-13-18(4)24(28-6-2)15-26(23)30-25/h7-16,28H,5-6H2,1-4H3/b19-9- |
| InChIKey | QZIORAIISUNVDB-OCKHKDLRSA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde?
The IUPAC name of 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde (CID 122463564) is 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde.
What is the SMILES notation for 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde?
The canonical SMILES for 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde is CC/C=c1/cc2c(cc1C)=C(c1ccccc1C=O)c1cc(C)c(NCC)cc1O2.
What is the InChIKey of 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde?
The InChIKey is QZIORAIISUNVDB-OCKHKDLRSA-N. The full InChI is InChI=1S/C27H27NO2/c1-5-9-19-14-25-22(12-17(19)3)27(21-11-8-7-10-20(21)16-29)23-13-18(4)24(28-6-2)15-26(23)30-25/h7-16,28H,5-6H2,1-4H3/b19-9-.
What are the key properties of 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde?
2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde has a molecular weight of 397.52 g/mol, XLogP of 5.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6Z)-3-(ethylamino)-2,7-dimethyl-6-propylidenexanthen-9-yl]benzaldehyde is sourced from PubChem (CID 122463564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).