C11H19NO2 — CID 122463678
(5E)-2-ethyl-5-hydroxyimino-2,3,3,4-tetramethylcyclopentan-1-one (PubChem CID 122463678) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (5E)-2-ethyl-5-hydroxyimino-2,3,3,4-tetramethylcyclopentan-1-one.
| Compound Name | (5E)-2-ethyl-5-hydroxyimino-2,3,3,4-tetramethylcyclopentan-1-one |
|---|---|
| PubChem CID | 122463678 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (5E)-2-ethyl-5-hydroxyimino-2,3,3,4-tetramethylcyclopentan-1-one |
| SMILES | CCC1(C)C(=O)/C(=N/O)C(C)C1(C)C |
| InChI | InChI=1S/C11H19NO2/c1-6-11(5)9(13)8(12-14)7(2)10(11,3)4/h7,14H,6H2,1-5H3/b12-8+ |
| InChIKey | SDSSAOYLLVQFDM-XYOKQWHBSA-N |
| XLogP | 2.48 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|