C21H26O4 — CID 122463828
(1S,4S,8R,12S,13R,15R,17R)-3,10,14,14,17-pentamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione (PubChem CID 122463828) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (1S,4S,8R,12S,13R,15R,17R)-3,10,14,14,17-pentamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione.
| Compound Name | (1S,4S,8R,12S,13R,15R,17R)-3,10,14,14,17-pentamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione |
|---|---|
| PubChem CID | 122463828 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (1S,4S,8R,12S,13R,15R,17R)-3,10,14,14,17-pentamethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione |
| SMILES | CC1=C[C@@H]2C(=O)[C@]3(C=C(C)[C@@H]4OC(=O)O[C@@]43C1)[C@H](C)C[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C21H26O4/c1-10-6-13-15-14(19(15,4)5)7-12(3)20(16(13)22)9-11(2)17-21(20,8-10)25-18(23)24-17/h6,9,12-15,17H,7-8H2,1-5H3/t12-,13+,14-,15+,17+,20+,21+/m1/s1 |
| InChIKey | QJNFSRNAUJUNHX-YRLMPFQYSA-N |
| XLogP | 4.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|