C12H13F5N2O3S — CID 122467211
(Z)-2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]ethenamine (PubChem CID 122467211) has the molecular formula C12H13F5N2O3S and a molecular weight of 360.30 g/mol. Its IUPAC name is (Z)-2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]ethenamine.
| Compound Name | (Z)-2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]ethenamine |
|---|---|
| PubChem CID | 122467211 |
| Molecular Formula | C12H13F5N2O3S |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (Z)-2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]ethenamine |
| SMILES | CCS(=O)(=O)/C=C(\N)c1ccc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H13F5N2O3S/c1-2-23(20,21)6-9(18)10-4-3-8(5-19-10)22-7-11(13,14)12(15,16)17/h3-6H,2,7,18H2,1H3/b9-6- |
| InChIKey | KXVLUMKJDZLUAF-TWGQIWQCSA-N |
| XLogP | 2.35 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|