C16H11ClF8N2O3S — CID 122467220
2-chloro-5-ethylsulfonyl-6-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-3-(trifluoromethyl)pyridine (PubChem CID 122467220) has the molecular formula C16H11ClF8N2O3S and a molecular weight of 498.78 g/mol. Its IUPAC name is 2-chloro-5-ethylsulfonyl-6-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-3-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-5-ethylsulfonyl-6-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 122467220 |
| Molecular Formula | C16H11ClF8N2O3S |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 2-chloro-5-ethylsulfonyl-6-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-3-(trifluoromethyl)pyridine |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)c(Cl)nc1-c1ccc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H11ClF8N2O3S/c1-2-31(28,29)11-5-9(15(20,21)22)13(17)27-12(11)10-4-3-8(6-26-10)30-7-14(18,19)16(23,24)25/h3-6H,2,7H2,1H3 |
| InChIKey | ABVMPVBLKCXBQC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|