C13H9F5N2O — CID 122467306
2-(3-fluoro-2-pyridinyl)-5-(2,2,3,3-tetrafluoropropoxy)pyridine (PubChem CID 122467306) has the molecular formula C13H9F5N2O and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-(3-fluoro-2-pyridinyl)-5-(2,2,3,3-tetrafluoropropoxy)pyridine.
| Compound Name | 2-(3-fluoro-2-pyridinyl)-5-(2,2,3,3-tetrafluoropropoxy)pyridine |
|---|---|
| PubChem CID | 122467306 |
| Molecular Formula | C13H9F5N2O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(3-fluoro-2-pyridinyl)-5-(2,2,3,3-tetrafluoropropoxy)pyridine |
| SMILES | Fc1cccnc1-c1ccc(OCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C13H9F5N2O/c14-9-2-1-5-19-11(9)10-4-3-8(6-20-10)21-7-13(17,18)12(15)16/h1-6,12H,7H2 |
| InChIKey | FUMHTJGFALPITQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|