About (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide
(3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 122467431) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide |
| PubChem CID | 122467431 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NC#N)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C7H12N4O/c1-9-7(10-5-8)11-3-2-6(12)4-11/h6,12H,2-4H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | FOIGVIFWQOANNN-LURJTMIESA-N |
| XLogP | -0.89 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide?
The IUPAC name of (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide (CID 122467431) is (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide.
What is the SMILES notation for (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide?
The canonical SMILES for (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide is C/N=C(\NC#N)N1CC[C@H](O)C1.
What is the InChIKey of (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide?
The InChIKey is FOIGVIFWQOANNN-LURJTMIESA-N. The full InChI is InChI=1S/C7H12N4O/c1-9-7(10-5-8)11-3-2-6(12)4-11/h6,12H,2-4H2,1H3,(H,9,10)/t6-/m0/s1.
What are the key properties of (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide?
(3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide has a molecular weight of 168.20 g/mol, XLogP of -0.89, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-cyano-3-hydroxy-N'-methylpyrrolidine-1-carboximidamide is sourced from PubChem (CID 122467431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).