C21H15ClF4N4O4S — CID 122467996
2-chloro-4-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-5-fluorobenzonitrile (PubChem CID 122467996) has the molecular formula C21H15ClF4N4O4S and a molecular weight of 530.89 g/mol. Its IUPAC name is 2-chloro-4-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-5-fluorobenzonitrile.
| Compound Name | 2-chloro-4-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 122467996 |
| Molecular Formula | C21H15ClF4N4O4S |
| Molecular Weight | 530.89 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | 2-chloro-4-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanyl-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(S[C@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)C2O)cc1Cl |
| InChI | InChI=1S/C21H15ClF4N4O4S/c22-10-4-16(11(23)3-9(10)5-27)35-21-20(33)18(19(32)15(7-31)34-21)30-6-14(28-29-30)8-1-12(24)17(26)13(25)2-8/h1-4,6,15,18-21,31-33H,7H2/t15?,18-,19-,20?,21+/m0/s1 |
| InChIKey | ISRZJDPKYGIWSM-RZTPSRECSA-N |
| XLogP | 2.80 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.89 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|