C21H19F3N4O5S — CID 122468051
3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylbenzamide (PubChem CID 122468051) has the molecular formula C21H19F3N4O5S and a molecular weight of 496.47 g/mol. Its IUPAC name is 3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylbenzamide.
| Compound Name | 3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 122468051 |
| Molecular Formula | C21H19F3N4O5S |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylbenzamide |
| SMILES | NC(=O)c1cccc(S[C@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)C2O)c1 |
| InChI | InChI=1S/C21H19F3N4O5S/c22-12-5-10(6-13(23)16(12)24)14-7-28(27-26-14)17-18(30)15(8-29)33-21(19(17)31)34-11-3-1-2-9(4-11)20(25)32/h1-7,15,17-19,21,29-31H,8H2,(H2,25,32)/t15?,17-,18-,19?,21+/m0/s1 |
| InChIKey | UKJYBOXDCNTVNT-PVKHWRBGSA-N |
| XLogP | 1.23 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|