C18H24F3N3O4S — CID 122468082
(2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxane-3,5-diol (PubChem CID 122468082) has the molecular formula C18H24F3N3O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is (2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxane-3,5-diol.
| Compound Name | (2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122468082 |
| Molecular Formula | C18H24F3N3O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (2R,4S,5R)-2-butylsulfanyl-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxane-3,5-diol |
| SMILES | CCCCS[C@H]1OC(CO)[C@H](O)[C@H](N2C=C(c3cc(F)c(F)c(F)c3)NN2)C1O |
| InChI | InChI=1S/C18H24F3N3O4S/c1-2-3-4-29-18-17(27)15(16(26)13(8-25)28-18)24-7-12(22-23-24)9-5-10(19)14(21)11(20)6-9/h5-7,13,15-18,22-23,25-27H,2-4,8H2,1H3/t13?,15-,16-,17?,18+/m0/s1 |
| InChIKey | TWXNCYDEJPYRAT-NYLKEFILSA-N |
| XLogP | 1.07 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|