C21H19F3N4O4S — CID 122468085
3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxan-2-yl]sulfanylbenzonitrile (PubChem CID 122468085) has the molecular formula C21H19F3N4O4S and a molecular weight of 480.47 g/mol. Its IUPAC name is 3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxan-2-yl]sulfanylbenzonitrile.
| Compound Name | 3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxan-2-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 122468085 |
| Molecular Formula | C21H19F3N4O4S |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 3-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[5-(3,4,5-trifluorophenyl)-1,2-dihydrotriazol-3-yl]oxan-2-yl]sulfanylbenzonitrile |
| SMILES | N#Cc1cccc(S[C@H]2OC(CO)[C@H](O)[C@H](N3C=C(c4cc(F)c(F)c(F)c4)NN3)C2O)c1 |
| InChI | InChI=1S/C21H19F3N4O4S/c22-13-5-11(6-14(23)17(13)24)15-8-28(27-26-15)18-19(30)16(9-29)32-21(20(18)31)33-12-3-1-2-10(4-12)7-25/h1-6,8,16,18-21,26-27,29-31H,9H2/t16?,18-,19-,20?,21+/m0/s1 |
| InChIKey | HJVYLHZLXUAKML-BVPMPBNFSA-N |
| XLogP | 1.20 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|