C20H22F5N3O4S — CID 122468087
(2R,4S,5R)-2-(3,3-difluorocyclohexyl)sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 122468087) has the molecular formula C20H22F5N3O4S and a molecular weight of 495.47 g/mol. Its IUPAC name is (2R,4S,5R)-2-(3,3-difluorocyclohexyl)sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,4S,5R)-2-(3,3-difluorocyclohexyl)sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122468087 |
| Molecular Formula | C20H22F5N3O4S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (2R,4S,5R)-2-(3,3-difluorocyclohexyl)sulfanyl-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OCC1O[C@H](SC2CCCC(F)(F)C2)C(O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C20H22F5N3O4S/c21-11-4-9(5-12(22)15(11)23)13-7-28(27-26-13)16-17(30)14(8-29)32-19(18(16)31)33-10-2-1-3-20(24,25)6-10/h4-5,7,10,14,16-19,29-31H,1-3,6,8H2/t10?,14?,16-,17-,18?,19+/m0/s1 |
| InChIKey | MDZAPALRCWXPFZ-KIYXKYIDSA-N |
| XLogP | 2.65 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|